C19H29N — CID 125489630
3-[(2S)-1-phenylpropan-2-yl]-3-azaspiro[5.5]undecane (PubChem CID 125489630) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 3-[(2S)-1-phenylpropan-2-yl]-3-azaspiro[5.5]undecane.
| Compound Name | 3-[(2S)-1-phenylpropan-2-yl]-3-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 125489630 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 3-[(2S)-1-phenylpropan-2-yl]-3-azaspiro[5.5]undecane |
| SMILES | C[C@@H](Cc1ccccc1)N1CCC2(CCCCC2)CC1 |
| InChI | InChI=1S/C19H29N/c1-17(16-18-8-4-2-5-9-18)20-14-12-19(13-15-20)10-6-3-7-11-19/h2,4-5,8-9,17H,3,6-7,10-16H2,1H3/t17-/m0/s1 |
| InChIKey | XTMJBOZPGNYHPG-KRWDZBQOSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |