C26H26N2O3 — CID 143935519
1,3-benzodioxol-5-yl-[4-[(1S)-1,2-diphenylethyl]piperazin-1-yl]methanone (PubChem CID 143935519) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-[(1S)-1,2-diphenylethyl]piperazin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-[(1S)-1,2-diphenylethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 143935519 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-[(1S)-1,2-diphenylethyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCN([C@@H](Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H26N2O3/c29-26(22-11-12-24-25(18-22)31-19-30-24)28-15-13-27(14-16-28)23(21-9-5-2-6-10-21)17-20-7-3-1-4-8-20/h1-12,18,23H,13-17,19H2/t23-/m0/s1 |
| InChIKey | XERAXZMLDVLLMC-QHCPKHFHSA-N |
| XLogP | 4.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |