C24H33Cl2FN2 — CID 132990928
1-cyclohexyl-4-[1-(3-fluorophenyl)-2-phenylethyl]piperazine;dihydrochloride (PubChem CID 132990928) has the molecular formula C24H33Cl2FN2 and a molecular weight of 439.45 g/mol. Its IUPAC name is 1-cyclohexyl-4-[1-(3-fluorophenyl)-2-phenylethyl]piperazine;dihydrochloride.
| Compound Name | 1-cyclohexyl-4-[1-(3-fluorophenyl)-2-phenylethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 132990928 |
| Molecular Formula | C24H33Cl2FN2 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1-cyclohexyl-4-[1-(3-fluorophenyl)-2-phenylethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1cccc(C(Cc2ccccc2)N2CCN(C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C24H31FN2.2ClH/c25-22-11-7-10-21(19-22)24(18-20-8-3-1-4-9-20)27-16-14-26(15-17-27)23-12-5-2-6-13-23;;/h1,3-4,7-11,19,23-24H,2,5-6,12-18H2;2*1H |
| InChIKey | BHNCRDCBSUJVEF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |