C20H25FN2 — CID 7047274
1-(4-fluorophenyl)-4-[(2R)-4-phenylbutan-2-yl]piperazine (PubChem CID 7047274) has the molecular formula C20H25FN2 and a molecular weight of 312.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(2R)-4-phenylbutan-2-yl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[(2R)-4-phenylbutan-2-yl]piperazine |
|---|---|
| PubChem CID | 7047274 |
| Molecular Formula | C20H25FN2 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(2R)-4-phenylbutan-2-yl]piperazine |
| SMILES | C[C@H](CCc1ccccc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H25FN2/c1-17(7-8-18-5-3-2-4-6-18)22-13-15-23(16-14-22)20-11-9-19(21)10-12-20/h2-6,9-12,17H,7-8,13-16H2,1H3/t17-/m1/s1 |
| InChIKey | CDARRQFNEBYXLP-QGZVFWFLSA-N |
| XLogP | 3.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |