C21H25F3N2 — CID 2846572
1-(4-phenylbutan-2-yl)-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 2846572) has the molecular formula C21H25F3N2 and a molecular weight of 362.44 g/mol. Its IUPAC name is 1-(4-phenylbutan-2-yl)-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-(4-phenylbutan-2-yl)-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 2846572 |
| Molecular Formula | C21H25F3N2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-(4-phenylbutan-2-yl)-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | CC(CCc1ccccc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H25F3N2/c1-17(10-11-18-6-3-2-4-7-18)25-12-14-26(15-13-25)20-9-5-8-19(16-20)21(22,23)24/h2-9,16-17H,10-15H2,1H3 |
| InChIKey | DTIZNRFBKSXDAV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |