C21H22F6N2 — CID 1375720
1-[3-(trifluoromethyl)phenyl]-4-[(2R)-1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperazine (PubChem CID 1375720) has the molecular formula C21H22F6N2 and a molecular weight of 416.41 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-4-[(2R)-1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperazine.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-4-[(2R)-1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperazine |
|---|---|
| PubChem CID | 1375720 |
| Molecular Formula | C21H22F6N2 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-4-[(2R)-1-[3-(trifluoromethyl)phenyl]propan-2-yl]piperazine |
| SMILES | C[C@H](Cc1cccc(C(F)(F)F)c1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H22F6N2/c1-15(12-16-4-2-5-17(13-16)20(22,23)24)28-8-10-29(11-9-28)19-7-3-6-18(14-19)21(25,26)27/h2-7,13-15H,8-12H2,1H3/t15-/m1/s1 |
| InChIKey | KCQBXTRGJHSTQQ-OAHLLOKOSA-N |
| XLogP | 5.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |