C14H12N10O12 — CID 160763059
N-(3-amino-2,4-dinitrophenyl)-N-[2-(3-amino-N,2,4-trinitroanilino)ethyl]nitramide (PubChem CID 160763059) has the molecular formula C14H12N10O12 and a molecular weight of 512.31 g/mol. Its IUPAC name is N-(3-amino-2,4-dinitrophenyl)-N-[2-(3-amino-N,2,4-trinitroanilino)ethyl]nitramide.
| Compound Name | N-(3-amino-2,4-dinitrophenyl)-N-[2-(3-amino-N,2,4-trinitroanilino)ethyl]nitramide |
|---|---|
| PubChem CID | 160763059 |
| Molecular Formula | C14H12N10O12 |
| Molecular Weight | 512.31 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | N-(3-amino-2,4-dinitrophenyl)-N-[2-(3-amino-N,2,4-trinitroanilino)ethyl]nitramide |
| SMILES | Nc1c([N+](=O)[O-])ccc(N(CCN(c2ccc([N+](=O)[O-])c(N)c2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N10O12/c15-11-7(19(25)26)1-3-9(13(11)21(29)30)17(23(33)34)5-6-18(24(35)36)10-4-2-8(20(27)28)12(16)14(10)22(31)32/h1-4H,5-6,15-16H2 |
| InChIKey | RYICAIVXDHWQAL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 317.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|