C15H12Cl2N6O8 — CID 135083420
N-[3-(4-chloro-N,2-dinitroanilino)propyl]-N-(4-chloro-2-nitrophenyl)nitramide (PubChem CID 135083420) has the molecular formula C15H12Cl2N6O8 and a molecular weight of 475.20 g/mol. Its IUPAC name is N-[3-(4-chloro-N,2-dinitroanilino)propyl]-N-(4-chloro-2-nitrophenyl)nitramide.
| Compound Name | N-[3-(4-chloro-N,2-dinitroanilino)propyl]-N-(4-chloro-2-nitrophenyl)nitramide |
|---|---|
| PubChem CID | 135083420 |
| Molecular Formula | C15H12Cl2N6O8 |
| Molecular Weight | 475.20 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | N-[3-(4-chloro-N,2-dinitroanilino)propyl]-N-(4-chloro-2-nitrophenyl)nitramide |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1N(CCCN(c1ccc(Cl)cc1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C15H12Cl2N6O8/c16-10-2-4-12(14(8-10)20(24)25)18(22(28)29)6-1-7-19(23(30)31)13-5-3-11(17)9-15(13)21(26)27/h2-5,8-9H,1,6-7H2 |
| InChIKey | FLZNOWSVRHBMER-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|