C12H12ClN3O2 — CID 54997319
3-(4-chloro-N-cyclopropyl-2-nitroanilino)propanenitrile (PubChem CID 54997319) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 3-(4-chloro-N-cyclopropyl-2-nitroanilino)propanenitrile.
| Compound Name | 3-(4-chloro-N-cyclopropyl-2-nitroanilino)propanenitrile |
|---|---|
| PubChem CID | 54997319 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-(4-chloro-N-cyclopropyl-2-nitroanilino)propanenitrile |
| SMILES | N#CCCN(c1ccc(Cl)cc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C12H12ClN3O2/c13-9-2-5-11(12(8-9)16(17)18)15(7-1-6-14)10-3-4-10/h2,5,8,10H,1,3-4,7H2 |
| InChIKey | VZXPCNIFRZTMAO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|