C15H15ClN2O2 — CID 114858348
(E)-3-[5-chloro-2-[2-cyanoethyl(cyclopropyl)amino]phenyl]prop-2-enoic acid (PubChem CID 114858348) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-[2-cyanoethyl(cyclopropyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-chloro-2-[2-cyanoethyl(cyclopropyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114858348 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (E)-3-[5-chloro-2-[2-cyanoethyl(cyclopropyl)amino]phenyl]prop-2-enoic acid |
| SMILES | N#CCCN(c1ccc(Cl)cc1/C=C/C(=O)O)C1CC1 |
| InChI | InChI=1S/C15H15ClN2O2/c16-12-3-6-14(11(10-12)2-7-15(19)20)18(9-1-8-17)13-4-5-13/h2-3,6-7,10,13H,1,4-5,9H2,(H,19,20)/b7-2+ |
| InChIKey | ZRJMIUFGPKWWIW-FARCUNLSSA-N |
| XLogP | 3.32 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|