C16H10N8O8 — CID 135083403
N-[2-(4-cyano-N,2-dinitroanilino)ethyl]-N-(4-cyano-2-nitrophenyl)nitramide (PubChem CID 135083403) has the molecular formula C16H10N8O8 and a molecular weight of 442.30 g/mol. Its IUPAC name is N-[2-(4-cyano-N,2-dinitroanilino)ethyl]-N-(4-cyano-2-nitrophenyl)nitramide.
| Compound Name | N-[2-(4-cyano-N,2-dinitroanilino)ethyl]-N-(4-cyano-2-nitrophenyl)nitramide |
|---|---|
| PubChem CID | 135083403 |
| Molecular Formula | C16H10N8O8 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | N-[2-(4-cyano-N,2-dinitroanilino)ethyl]-N-(4-cyano-2-nitrophenyl)nitramide |
| SMILES | N#Cc1ccc(N(CCN(c2ccc(C#N)cc2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10N8O8/c17-9-11-1-3-13(15(7-11)21(25)26)19(23(29)30)5-6-20(24(31)32)14-4-2-12(10-18)8-16(14)22(27)28/h1-4,7-8H,5-6H2 |
| InChIKey | YPGKDPXKMRBEJN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 226.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|