C12H6N8O12 — CID 57376603
3-nitro-6-(2,3,4,5,6-pentanitrophenyl)benzene-1,2-diamine (PubChem CID 57376603) has the molecular formula C12H6N8O12 and a molecular weight of 454.22 g/mol. Its IUPAC name is 3-nitro-6-(2,3,4,5,6-pentanitrophenyl)benzene-1,2-diamine.
| Compound Name | 3-nitro-6-(2,3,4,5,6-pentanitrophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 57376603 |
| Molecular Formula | C12H6N8O12 |
| Molecular Weight | 454.22 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 3-nitro-6-(2,3,4,5,6-pentanitrophenyl)benzene-1,2-diamine |
| SMILES | Nc1c(-c2c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c2[N+](=O)[O-])ccc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C12H6N8O12/c13-6-3(1-2-4(7(6)14)15(21)22)5-8(16(23)24)10(18(27)28)12(20(31)32)11(19(29)30)9(5)17(25)26/h1-2H,13-14H2 |
| InChIKey | HNFXEIWTTMVAMC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 310.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|