C12N10O20 — CID 13070457
1,2,3,4,5-pentanitro-6-(2,3,4,5,6-pentanitrophenyl)benzene (PubChem CID 13070457) has the molecular formula C12N10O20 and a molecular weight of 604.18 g/mol. Its IUPAC name is 1,2,3,4,5-pentanitro-6-(2,3,4,5,6-pentanitrophenyl)benzene.
| Compound Name | 1,2,3,4,5-pentanitro-6-(2,3,4,5,6-pentanitrophenyl)benzene |
|---|---|
| PubChem CID | 13070457 |
| Molecular Formula | C12N10O20 |
| Molecular Weight | 604.18 g/mol |
| Exact Mass | 603.93 |
| IUPAC Name | 1,2,3,4,5-pentanitro-6-(2,3,4,5,6-pentanitrophenyl)benzene |
| SMILES | O=[N+]([O-])c1c(-c2c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c2[N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C12N10O20/c23-13(24)3-1(4(14(25)26)8(18(33)34)11(21(39)40)7(3)17(31)32)2-5(15(27)28)9(19(35)36)12(22(41)42)10(20(37)38)6(2)16(29)30 |
| InChIKey | BOLMRKSMYRIFKC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 431.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|