C18H5N9O18 — CID 22253780
1,2,3,4-tetranitro-5-(2,3,4,5,6-pentanitrophenyl)-6-phenylbenzene (PubChem CID 22253780) has the molecular formula C18H5N9O18 and a molecular weight of 635.28 g/mol. Its IUPAC name is 1,2,3,4-tetranitro-5-(2,3,4,5,6-pentanitrophenyl)-6-phenylbenzene.
| Compound Name | 1,2,3,4-tetranitro-5-(2,3,4,5,6-pentanitrophenyl)-6-phenylbenzene |
|---|---|
| PubChem CID | 22253780 |
| Molecular Formula | C18H5N9O18 |
| Molecular Weight | 635.28 g/mol |
| Exact Mass | 634.98 |
| IUPAC Name | 1,2,3,4-tetranitro-5-(2,3,4,5,6-pentanitrophenyl)-6-phenylbenzene |
| SMILES | O=[N+]([O-])c1c(-c2ccccc2)c(-c2c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c2[N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H5N9O18/c28-19(29)10-7(6-4-2-1-3-5-6)8(11(20(30)31)15(24(38)39)14(10)23(36)37)9-12(21(32)33)16(25(40)41)18(27(44)45)17(26(42)43)13(9)22(34)35/h1-5H |
| InChIKey | LOWWCCYTZIZYDK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 388.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.28 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|