C30H21NO3 — CID 118436800
4-nitro-2,3,5,6-tetraphenylphenol (PubChem CID 118436800) has the molecular formula C30H21NO3 and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-nitro-2,3,5,6-tetraphenylphenol.
| Compound Name | 4-nitro-2,3,5,6-tetraphenylphenol |
|---|---|
| PubChem CID | 118436800 |
| Molecular Formula | C30H21NO3 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-nitro-2,3,5,6-tetraphenylphenol |
| SMILES | O=[N+]([O-])c1c(-c2ccccc2)c(-c2ccccc2)c(O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H21NO3/c32-30-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)29(31(33)34)26(22-15-7-2-8-16-22)28(30)24-19-11-4-12-20-24/h1-20,32H |
| InChIKey | LXHBFGJRPFCNTC-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|