C18H15N3O2 — CID 170838377
(3-nitro-2,4-diphenylphenyl)hydrazine (PubChem CID 170838377) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is (3-nitro-2,4-diphenylphenyl)hydrazine.
| Compound Name | (3-nitro-2,4-diphenylphenyl)hydrazine |
|---|---|
| PubChem CID | 170838377 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (3-nitro-2,4-diphenylphenyl)hydrazine |
| SMILES | NNc1ccc(-c2ccccc2)c([N+](=O)[O-])c1-c1ccccc1 |
| InChI | InChI=1S/C18H15N3O2/c19-20-16-12-11-15(13-7-3-1-4-8-13)18(21(22)23)17(16)14-9-5-2-6-10-14/h1-12,20H,19H2 |
| InChIKey | CDKRYZZAFXINJE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|