About 3-hydrazinyl-5-nitro-2,4-diphenylaniline
3-hydrazinyl-5-nitro-2,4-diphenylaniline (PubChem CID 18954135) has the molecular formula C18H16N4O2
and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-hydrazinyl-5-nitro-2,4-diphenylaniline.
Molecular Properties
| Compound Name | 3-hydrazinyl-5-nitro-2,4-diphenylaniline |
| PubChem CID | 18954135 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-hydrazinyl-5-nitro-2,4-diphenylaniline |
| SMILES | NNc1c(-c2ccccc2)c(N)cc([N+](=O)[O-])c1-c1ccccc1 |
| InChI | InChI=1S/C18H16N4O2/c19-14-11-15(22(23)24)17(13-9-5-2-6-10-13)18(21-20)16(14)12-7-3-1-4-8-12/h1-11,21H,19-20H2 |
| InChIKey | IMGAYHVYDAMQMB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydrazinyl-5-nitro-2,4-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydrazinyl-5-nitro-2,4-diphenylaniline?
The IUPAC name of 3-hydrazinyl-5-nitro-2,4-diphenylaniline (CID 18954135) is 3-hydrazinyl-5-nitro-2,4-diphenylaniline.
What is the SMILES notation for 3-hydrazinyl-5-nitro-2,4-diphenylaniline?
The canonical SMILES for 3-hydrazinyl-5-nitro-2,4-diphenylaniline is NNc1c(-c2ccccc2)c(N)cc([N+](=O)[O-])c1-c1ccccc1.
What is the InChIKey of 3-hydrazinyl-5-nitro-2,4-diphenylaniline?
The InChIKey is IMGAYHVYDAMQMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O2/c19-14-11-15(22(23)24)17(13-9-5-2-6-10-13)18(21-20)16(14)12-7-3-1-4-8-12/h1-11,21H,19-20H2.
What are the key properties of 3-hydrazinyl-5-nitro-2,4-diphenylaniline?
3-hydrazinyl-5-nitro-2,4-diphenylaniline has a molecular weight of 320.35 g/mol, XLogP of 3.80, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinyl-5-nitro-2,4-diphenylaniline is sourced from PubChem (CID 18954135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).