C12H7N3O7 — CID 87364984
3,4,5-trinitro-2-phenylphenol (PubChem CID 87364984) has the molecular formula C12H7N3O7 and a molecular weight of 305.20 g/mol. Its IUPAC name is 3,4,5-trinitro-2-phenylphenol.
| Compound Name | 3,4,5-trinitro-2-phenylphenol |
|---|---|
| PubChem CID | 87364984 |
| Molecular Formula | C12H7N3O7 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 3,4,5-trinitro-2-phenylphenol |
| SMILES | O=[N+]([O-])c1cc(O)c(-c2ccccc2)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7N3O7/c16-9-6-8(13(17)18)11(14(19)20)12(15(21)22)10(9)7-4-2-1-3-5-7/h1-6,16H |
| InChIKey | MJFGITTWJFOLBC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|