About sodium;hydride;3-nitro-2-phenylphenol
sodium;hydride;3-nitro-2-phenylphenol (PubChem CID 175105710) has the molecular formula C12H10NNaO3
and a molecular weight of 239.21 g/mol. Its IUPAC name is sodium;hydride;3-nitro-2-phenylphenol.
Molecular Properties
| Compound Name | sodium;hydride;3-nitro-2-phenylphenol |
| PubChem CID | 175105710 |
| Molecular Formula | C12H10NNaO3 |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | sodium;hydride;3-nitro-2-phenylphenol |
| SMILES | O=[N+]([O-])c1cccc(O)c1-c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C12H9NO3.Na.H/c14-11-8-4-7-10(13(15)16)12(11)9-5-2-1-3-6-9;;/h1-8,14H;;/q;+1;-1 |
| InChIKey | OPRURPJXPWHRAH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;3-nitro-2-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-nitro-2-phenylphenol?
The IUPAC name of sodium;hydride;3-nitro-2-phenylphenol (CID 175105710) is sodium;hydride;3-nitro-2-phenylphenol.
What is the SMILES notation for sodium;hydride;3-nitro-2-phenylphenol?
The canonical SMILES for sodium;hydride;3-nitro-2-phenylphenol is O=[N+]([O-])c1cccc(O)c1-c1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-nitro-2-phenylphenol?
The InChIKey is OPRURPJXPWHRAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3.Na.H/c14-11-8-4-7-10(13(15)16)12(11)9-5-2-1-3-6-9;;/h1-8,14H;;/q;+1;-1.
What are the key properties of sodium;hydride;3-nitro-2-phenylphenol?
sodium;hydride;3-nitro-2-phenylphenol has a molecular weight of 239.21 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-nitro-2-phenylphenol is sourced from PubChem (CID 175105710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).