C13H8N2O7 — CID 88507733
(3,6-dihydroxy-2,4-dinitrophenyl)-phenylmethanone (PubChem CID 88507733) has the molecular formula C13H8N2O7 and a molecular weight of 304.21 g/mol. Its IUPAC name is (3,6-dihydroxy-2,4-dinitrophenyl)-phenylmethanone.
| Compound Name | (3,6-dihydroxy-2,4-dinitrophenyl)-phenylmethanone |
|---|---|
| PubChem CID | 88507733 |
| Molecular Formula | C13H8N2O7 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | (3,6-dihydroxy-2,4-dinitrophenyl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(O)cc([N+](=O)[O-])c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8N2O7/c16-9-6-8(14(19)20)13(18)11(15(21)22)10(9)12(17)7-4-2-1-3-5-7/h1-6,16,18H |
| InChIKey | PDZCGKSAUKOJLX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|