C20H12N2O12 — CID 54017802
[4-(2,3,4-trihydroxy-5-nitrobenzoyl)phenyl]-(2,3,4-trihydroxy-5-nitrophenyl)methanone (PubChem CID 54017802) has the molecular formula C20H12N2O12 and a molecular weight of 472.32 g/mol. Its IUPAC name is [4-(2,3,4-trihydroxy-5-nitrobenzoyl)phenyl]-(2,3,4-trihydroxy-5-nitrophenyl)methanone.
| Compound Name | [4-(2,3,4-trihydroxy-5-nitrobenzoyl)phenyl]-(2,3,4-trihydroxy-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 54017802 |
| Molecular Formula | C20H12N2O12 |
| Molecular Weight | 472.32 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | [4-(2,3,4-trihydroxy-5-nitrobenzoyl)phenyl]-(2,3,4-trihydroxy-5-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(C(=O)c2cc([N+](=O)[O-])c(O)c(O)c2O)cc1)c1cc([N+](=O)[O-])c(O)c(O)c1O |
| InChI | InChI=1S/C20H12N2O12/c23-13(9-5-11(21(31)32)17(27)19(29)15(9)25)7-1-2-8(4-3-7)14(24)10-6-12(22(33)34)18(28)20(30)16(10)26/h1-6,25-30H |
| InChIKey | KWUMPOHPFZRMME-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 241.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|