C15H11NO6 — CID 137253741
2,3-dihydroxy-6-methyl-5-(4-nitrobenzoyl)cyclohepta-2,4,6-trien-1-one (PubChem CID 137253741) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is 2,3-dihydroxy-6-methyl-5-(4-nitrobenzoyl)cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2,3-dihydroxy-6-methyl-5-(4-nitrobenzoyl)cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 137253741 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2,3-dihydroxy-6-methyl-5-(4-nitrobenzoyl)cyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1cc(=O)c(O)c(O)cc1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11NO6/c1-8-6-12(17)15(20)13(18)7-11(8)14(19)9-2-4-10(5-3-9)16(21)22/h2-7H,1H3,(H2,17,18,20) |
| InChIKey | DUMGAOFMGANHKP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|