C18H13NO5 — CID 91036142
(1,4-dihydroxy-3-methylnaphthalen-2-yl)-(4-nitrophenyl)methanone (PubChem CID 91036142) has the molecular formula C18H13NO5 and a molecular weight of 323.30 g/mol. Its IUPAC name is (1,4-dihydroxy-3-methylnaphthalen-2-yl)-(4-nitrophenyl)methanone.
| Compound Name | (1,4-dihydroxy-3-methylnaphthalen-2-yl)-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 91036142 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (1,4-dihydroxy-3-methylnaphthalen-2-yl)-(4-nitrophenyl)methanone |
| SMILES | Cc1c(C(=O)c2ccc([N+](=O)[O-])cc2)c(O)c2ccccc2c1O |
| InChI | InChI=1S/C18H13NO5/c1-10-15(17(21)11-6-8-12(9-7-11)19(23)24)18(22)14-5-3-2-4-13(14)16(10)20/h2-9,20,22H,1H3 |
| InChIKey | CHFGUVABAOSLSF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|