C18H13FN2O2 — CID 156538727
3-fluoro-5-nitro-N,4-diphenylaniline (PubChem CID 156538727) has the molecular formula C18H13FN2O2 and a molecular weight of 308.31 g/mol. Its IUPAC name is 3-fluoro-5-nitro-N,4-diphenylaniline.
| Compound Name | 3-fluoro-5-nitro-N,4-diphenylaniline |
|---|---|
| PubChem CID | 156538727 |
| Molecular Formula | C18H13FN2O2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-fluoro-5-nitro-N,4-diphenylaniline |
| SMILES | O=[N+]([O-])c1cc(Nc2ccccc2)cc(F)c1-c1ccccc1 |
| InChI | InChI=1S/C18H13FN2O2/c19-16-11-15(20-14-9-5-2-6-10-14)12-17(21(22)23)18(16)13-7-3-1-4-8-13/h1-12,20H |
| InChIKey | GLFNJXYPTVCTHV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|