C24H18NO2P — CID 19382090
(2-nitro-3,4,5-triphenylphenyl)phosphane (PubChem CID 19382090) has the molecular formula C24H18NO2P and a molecular weight of 383.39 g/mol. Its IUPAC name is (2-nitro-3,4,5-triphenylphenyl)phosphane.
| Compound Name | (2-nitro-3,4,5-triphenylphenyl)phosphane |
|---|---|
| PubChem CID | 19382090 |
| Molecular Formula | C24H18NO2P |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (2-nitro-3,4,5-triphenylphenyl)phosphane |
| SMILES | O=[N+]([O-])c1c(P)cc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H18NO2P/c26-25(27)24-21(28)16-20(17-10-4-1-5-11-17)22(18-12-6-2-7-13-18)23(24)19-14-8-3-9-15-19/h1-16H,28H2 |
| InChIKey | CFFCATDASJRPQF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|