About 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide
2,3,6-triphenyl-5-phosphanylphenol;hydrobromide (PubChem CID 173058074) has the molecular formula C24H20BrOP
and a molecular weight of 435.30 g/mol. Its IUPAC name is 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide.
Molecular Properties
| Compound Name | 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide |
| PubChem CID | 173058074 |
| Molecular Formula | C24H20BrOP |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide |
| SMILES | Br.Oc1c(-c2ccccc2)c(P)cc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H19OP.BrH/c25-24-22(18-12-6-2-7-13-18)20(17-10-4-1-5-11-17)16-21(26)23(24)19-14-8-3-9-15-19;/h1-16,25H,26H2;1H |
| InChIKey | GJGVVHVZWUTQFP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide?
The IUPAC name of 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide (CID 173058074) is 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide.
What is the SMILES notation for 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide?
The canonical SMILES for 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide is Br.Oc1c(-c2ccccc2)c(P)cc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide?
The InChIKey is GJGVVHVZWUTQFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19OP.BrH/c25-24-22(18-12-6-2-7-13-18)20(17-10-4-1-5-11-17)16-21(26)23(24)19-14-8-3-9-15-19;/h1-16,25H,26H2;1H.
What are the key properties of 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide?
2,3,6-triphenyl-5-phosphanylphenol;hydrobromide has a molecular weight of 435.30 g/mol, XLogP of 6.47, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-triphenyl-5-phosphanylphenol;hydrobromide is sourced from PubChem (CID 173058074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).