C25H18O3S — CID 141461365
sulfanyl 2-hydroxy-3,4,5-triphenylbenzoate (PubChem CID 141461365) has the molecular formula C25H18O3S and a molecular weight of 398.48 g/mol. Its IUPAC name is sulfanyl 2-hydroxy-3,4,5-triphenylbenzoate.
| Compound Name | sulfanyl 2-hydroxy-3,4,5-triphenylbenzoate |
|---|---|
| PubChem CID | 141461365 |
| Molecular Formula | C25H18O3S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | sulfanyl 2-hydroxy-3,4,5-triphenylbenzoate |
| SMILES | O=C(OS)c1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1O |
| InChI | InChI=1S/C25H18O3S/c26-24-21(25(27)28-29)16-20(17-10-4-1-5-11-17)22(18-12-6-2-7-13-18)23(24)19-14-8-3-9-15-19/h1-16,26,29H |
| InChIKey | JTONKHOOGAHKLI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|