C26H20O3 — CID 10948907
(2-hydroxy-5-methoxy-3,4-diphenylphenyl)-phenylmethanone (PubChem CID 10948907) has the molecular formula C26H20O3 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2-hydroxy-5-methoxy-3,4-diphenylphenyl)-phenylmethanone.
| Compound Name | (2-hydroxy-5-methoxy-3,4-diphenylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 10948907 |
| Molecular Formula | C26H20O3 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (2-hydroxy-5-methoxy-3,4-diphenylphenyl)-phenylmethanone |
| SMILES | COc1cc(C(=O)c2ccccc2)c(O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H20O3/c1-29-22-17-21(25(27)20-15-9-4-10-16-20)26(28)24(19-13-7-3-8-14-19)23(22)18-11-5-2-6-12-18/h2-17,28H,1H3 |
| InChIKey | ULJSFHTVNMZBKV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |