C25H18O4 — CID 172846091
phenyl-(2,3,4-trihydroxy-5,6-diphenylphenyl)methanone (PubChem CID 172846091) has the molecular formula C25H18O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is phenyl-(2,3,4-trihydroxy-5,6-diphenylphenyl)methanone.
| Compound Name | phenyl-(2,3,4-trihydroxy-5,6-diphenylphenyl)methanone |
|---|---|
| PubChem CID | 172846091 |
| Molecular Formula | C25H18O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | phenyl-(2,3,4-trihydroxy-5,6-diphenylphenyl)methanone |
| SMILES | O=C(c1ccccc1)c1c(O)c(O)c(O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H18O4/c26-22(18-14-8-3-9-15-18)21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)23(27)25(29)24(21)28/h1-15,27-29H |
| InChIKey | XLEQTTKMXIZYSJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|