C13H8N6O4 — CID 150802254
(2,3-diazido-4,5,6-trihydroxyphenyl)-phenylmethanone (PubChem CID 150802254) has the molecular formula C13H8N6O4 and a molecular weight of 312.25 g/mol. Its IUPAC name is (2,3-diazido-4,5,6-trihydroxyphenyl)-phenylmethanone.
| Compound Name | (2,3-diazido-4,5,6-trihydroxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 150802254 |
| Molecular Formula | C13H8N6O4 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (2,3-diazido-4,5,6-trihydroxyphenyl)-phenylmethanone |
| SMILES | [N-]=[N+]=Nc1c(O)c(O)c(O)c(C(=O)c2ccccc2)c1N=[N+]=[N-] |
| InChI | InChI=1S/C13H8N6O4/c14-18-16-8-7(10(20)6-4-2-1-3-5-6)11(21)13(23)12(22)9(8)17-19-15/h1-5,21-23H |
| InChIKey | KGCRLPITKGLQFY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 175.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|