2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid

C13H10O8S — CID 22357386

IUPAC2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid
SMILESO=C(c1ccccc1)c1c(O)c(O)c(O)c(O)c1S(=O)(=O)O
InChIInChI=1S/C13H10O8S/c14-8(6-4-2-1-3-5-6)7-9(15)10(16)11(17)12(18)13(7)22(19,20)21/h1-5,15-18H,(H,19,20,21)
InChIKeyPXMXHRIOJBEUBR-UHFFFAOYSA-N
MW326.28 g/mol
LogP0.99
Rot. Bonds3

About 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid

2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid (PubChem CID 22357386) has the molecular formula C13H10O8S and a molecular weight of 326.28 g/mol. Its IUPAC name is 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid.

Molecular Properties

Compound Name2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid
PubChem CID22357386
Molecular FormulaC13H10O8S
Molecular Weight326.28 g/mol
Exact Mass326.01
IUPAC Name2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid
SMILESO=C(c1ccccc1)c1c(O)c(O)c(O)c(O)c1S(=O)(=O)O
InChIInChI=1S/C13H10O8S/c14-8(6-4-2-1-3-5-6)7-9(15)10(16)11(17)12(18)13(7)22(19,20)21/h1-5,15-18H,(H,19,20,21)
InChIKeyPXMXHRIOJBEUBR-UHFFFAOYSA-N
XLogP0.99
TPSA152.36 Ų
H-Bond Donors5
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.28
LogP ≤ 50.99
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid?
The IUPAC name of 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid (CID 22357386) is 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid.
What is the SMILES notation for 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid?
The canonical SMILES for 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid is O=C(c1ccccc1)c1c(O)c(O)c(O)c(O)c1S(=O)(=O)O.
What is the InChIKey of 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid?
The InChIKey is PXMXHRIOJBEUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O8S/c14-8(6-4-2-1-3-5-6)7-9(15)10(16)11(17)12(18)13(7)22(19,20)21/h1-5,15-18H,(H,19,20,21).
What are the key properties of 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid?
2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid has a molecular weight of 326.28 g/mol, XLogP of 0.99, 3 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid is sourced from PubChem (CID 22357386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).