C13H10O8S — CID 22357386
2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid (PubChem CID 22357386) has the molecular formula C13H10O8S and a molecular weight of 326.28 g/mol. Its IUPAC name is 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid.
| Compound Name | 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 22357386 |
| Molecular Formula | C13H10O8S |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2-benzoyl-3,4,5,6-tetrahydroxybenzenesulfonic acid |
| SMILES | O=C(c1ccccc1)c1c(O)c(O)c(O)c(O)c1S(=O)(=O)O |
| InChI | InChI=1S/C13H10O8S/c14-8(6-4-2-1-3-5-6)7-9(15)10(16)11(17)12(18)13(7)22(19,20)21/h1-5,15-18H,(H,19,20,21) |
| InChIKey | PXMXHRIOJBEUBR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|