C27H22O7 — CID 159803973
(2,3-dihydroxy-4-methoxyphenyl)-phenylmethanone;(2,4-dihydroxyphenyl)-phenylmethanone (PubChem CID 159803973) has the molecular formula C27H22O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is (2,3-dihydroxy-4-methoxyphenyl)-phenylmethanone;(2,4-dihydroxyphenyl)-phenylmethanone.
| Compound Name | (2,3-dihydroxy-4-methoxyphenyl)-phenylmethanone;(2,4-dihydroxyphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 159803973 |
| Molecular Formula | C27H22O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (2,3-dihydroxy-4-methoxyphenyl)-phenylmethanone;(2,4-dihydroxyphenyl)-phenylmethanone |
| SMILES | COc1ccc(C(=O)c2ccccc2)c(O)c1O.O=C(c1ccccc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H12O4.C13H10O3/c1-18-11-8-7-10(13(16)14(11)17)12(15)9-5-3-2-4-6-9;14-10-6-7-11(12(15)8-10)13(16)9-4-2-1-3-5-9/h2-8,16-17H,1H3;1-8,14-15H |
| InChIKey | NKDPTCDLHUXAQZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|