C21H16O8 — CID 129260019
[4-(2,3-dihydroxy-4-methoxybenzoyl)-2,6-dihydroxyphenyl] benzoate (PubChem CID 129260019) has the molecular formula C21H16O8 and a molecular weight of 396.35 g/mol. Its IUPAC name is [4-(2,3-dihydroxy-4-methoxybenzoyl)-2,6-dihydroxyphenyl] benzoate.
| Compound Name | [4-(2,3-dihydroxy-4-methoxybenzoyl)-2,6-dihydroxyphenyl] benzoate |
|---|---|
| PubChem CID | 129260019 |
| Molecular Formula | C21H16O8 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [4-(2,3-dihydroxy-4-methoxybenzoyl)-2,6-dihydroxyphenyl] benzoate |
| SMILES | COc1ccc(C(=O)c2cc(O)c(OC(=O)c3ccccc3)c(O)c2)c(O)c1O |
| InChI | InChI=1S/C21H16O8/c1-28-16-8-7-13(18(25)19(16)26)17(24)12-9-14(22)20(15(23)10-12)29-21(27)11-5-3-2-4-6-11/h2-10,22-23,25-26H,1H3 |
| InChIKey | ONSQYXBCAJOXDU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|