C14H12O7 — CID 19910404
(2,3-dihydroxy-4-methoxyphenyl)-(2,4,6-trihydroxyphenyl)methanone (PubChem CID 19910404) has the molecular formula C14H12O7 and a molecular weight of 292.24 g/mol. Its IUPAC name is (2,3-dihydroxy-4-methoxyphenyl)-(2,4,6-trihydroxyphenyl)methanone.
| Compound Name | (2,3-dihydroxy-4-methoxyphenyl)-(2,4,6-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 19910404 |
| Molecular Formula | C14H12O7 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (2,3-dihydroxy-4-methoxyphenyl)-(2,4,6-trihydroxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2c(O)cc(O)cc2O)c(O)c1O |
| InChI | InChI=1S/C14H12O7/c1-21-10-3-2-7(13(19)14(10)20)12(18)11-8(16)4-6(15)5-9(11)17/h2-5,15-17,19-20H,1H3 |
| InChIKey | PKJVBOQJHMYKEI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|