C52H40O28 — CID 158519413
bis(2,4,6-trihydroxyphenyl)methanone;(2,3,5-trihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone;bis((2,4,5-trihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone) (PubChem CID 158519413) has the molecular formula C52H40O28 and a molecular weight of 1112.86 g/mol. Its IUPAC name is bis(2,4,6-trihydroxyphenyl)methanone;(2,3,5-trihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone;bis((2,4,5-trihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone).
| Compound Name | bis(2,4,6-trihydroxyphenyl)methanone;(2,3,5-trihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone;bis((2,4,5-trihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone) |
|---|---|
| PubChem CID | 158519413 |
| Molecular Formula | C52H40O28 |
| Molecular Weight | 1112.86 g/mol |
| Exact Mass | 1112.17 |
| IUPAC Name | bis(2,4,6-trihydroxyphenyl)methanone;(2,3,5-trihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone;bis((2,4,5-trihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone) |
| SMILES | O=C(c1c(O)cc(O)cc1O)c1c(O)cc(O)cc1O.O=C(c1cc(O)c(O)cc1O)c1c(O)cc(O)cc1O.O=C(c1cc(O)c(O)cc1O)c1c(O)cc(O)cc1O.O=C(c1cc(O)cc(O)c1O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/4C13H10O7/c14-5-1-7(12(19)10(18)4-5)13(20)11-8(16)2-6(15)3-9(11)17;2*14-5-1-10(18)12(11(19)2-5)13(20)6-3-8(16)9(17)4-7(6)15;14-5-1-7(16)11(8(17)2-5)13(20)12-9(18)3-6(15)4-10(12)19/h4*1-4,14-19H |
| InChIKey | HMALWPSGDMIEEZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 553.80 Ų |
| H-Bond Donors | 24 |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1112.86 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 24 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|