C13H10O7 — CID 21446297
(2,4,5-trihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 21446297) has the molecular formula C13H10O7 and a molecular weight of 278.22 g/mol. Its IUPAC name is (2,4,5-trihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | (2,4,5-trihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 21446297 |
| Molecular Formula | C13H10O7 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (2,4,5-trihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)c1cc(O)c(O)cc1O |
| InChI | InChI=1S/C13H10O7/c14-7-4-9(16)8(15)3-6(7)12(19)5-1-10(17)13(20)11(18)2-5/h1-4,14-18,20H |
| InChIKey | UJRCLQKWHGZVBV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|