C16H16O6 — CID 71370456
2-(2,5-dimethoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone (PubChem CID 71370456) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone.
| Compound Name | 2-(2,5-dimethoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 71370456 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| SMILES | COc1ccc(OC)c(CC(=O)c2c(O)cc(O)cc2O)c1 |
| InChI | InChI=1S/C16H16O6/c1-21-11-3-4-15(22-2)9(5-11)6-12(18)16-13(19)7-10(17)8-14(16)20/h3-5,7-8,17,19-20H,6H2,1-2H3 |
| InChIKey | QCBAUJPHTDEXIB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |