C14H18O5 — CID 91288887
[2-(2,5-dimethoxyphenyl)acetyl] butanoate (PubChem CID 91288887) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)acetyl] butanoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)acetyl] butanoate |
|---|---|
| PubChem CID | 91288887 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)acetyl] butanoate |
| SMILES | CCCC(=O)OC(=O)Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H18O5/c1-4-5-13(15)19-14(16)9-10-8-11(17-2)6-7-12(10)18-3/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | UMMROZFRMOGGHV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|