C15H20O5 — CID 69125375
1-(2,5-dimethoxyphenyl)-7-hydroxyheptane-2,3-dione (PubChem CID 69125375) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-7-hydroxyheptane-2,3-dione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-7-hydroxyheptane-2,3-dione |
|---|---|
| PubChem CID | 69125375 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-7-hydroxyheptane-2,3-dione |
| SMILES | COc1ccc(OC)c(CC(=O)C(=O)CCCCO)c1 |
| InChI | InChI=1S/C15H20O5/c1-19-12-6-7-15(20-2)11(9-12)10-14(18)13(17)5-3-4-8-16/h6-7,9,16H,3-5,8,10H2,1-2H3 |
| InChIKey | DBCYTNAHFQNUQH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|