C15H14O5 — CID 905962
2-(2-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone (PubChem CID 905962) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone.
| Compound Name | 2-(2-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 905962 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| SMILES | COc1ccccc1CC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C15H14O5/c1-20-14-5-3-2-4-9(14)6-11(17)15-12(18)7-10(16)8-13(15)19/h2-5,7-8,16,18-19H,6H2,1H3 |
| InChIKey | JXHCBDZUPWMLDA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |