C15H10Cl4O2 — CID 105349407
2-(2-methoxyphenyl)-1-(2,3,4,6-tetrachlorophenyl)ethanone (PubChem CID 105349407) has the molecular formula C15H10Cl4O2 and a molecular weight of 364.06 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-(2,3,4,6-tetrachlorophenyl)ethanone.
| Compound Name | 2-(2-methoxyphenyl)-1-(2,3,4,6-tetrachlorophenyl)ethanone |
|---|---|
| PubChem CID | 105349407 |
| Molecular Formula | C15H10Cl4O2 |
| Molecular Weight | 364.06 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-(2,3,4,6-tetrachlorophenyl)ethanone |
| SMILES | COc1ccccc1CC(=O)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H10Cl4O2/c1-21-12-5-3-2-4-8(12)6-11(20)13-9(16)7-10(17)14(18)15(13)19/h2-5,7H,6H2,1H3 |
| InChIKey | ZRWODPGNWJRNMH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.06 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|