C22H19NO4 — CID 11581299
dimethyl 3-amino-4,5-diphenylbenzene-1,2-dicarboxylate (PubChem CID 11581299) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is dimethyl 3-amino-4,5-diphenylbenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3-amino-4,5-diphenylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11581299 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | dimethyl 3-amino-4,5-diphenylbenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)c(-c2ccccc2)c(N)c1C(=O)OC |
| InChI | InChI=1S/C22H19NO4/c1-26-21(24)17-13-16(14-9-5-3-6-10-14)18(15-11-7-4-8-12-15)20(23)19(17)22(25)27-2/h3-13H,23H2,1-2H3 |
| InChIKey | XYZPADYJASHWDN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|