C24H19NO8 — CID 102205935
trimethyl 6-(4-nitrophenyl)-3-phenylbenzene-1,2,4-tricarboxylate (PubChem CID 102205935) has the molecular formula C24H19NO8 and a molecular weight of 449.42 g/mol. Its IUPAC name is trimethyl 6-(4-nitrophenyl)-3-phenylbenzene-1,2,4-tricarboxylate.
| Compound Name | trimethyl 6-(4-nitrophenyl)-3-phenylbenzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 102205935 |
| Molecular Formula | C24H19NO8 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | trimethyl 6-(4-nitrophenyl)-3-phenylbenzene-1,2,4-tricarboxylate |
| SMILES | COC(=O)c1cc(-c2ccc([N+](=O)[O-])cc2)c(C(=O)OC)c(C(=O)OC)c1-c1ccccc1 |
| InChI | InChI=1S/C24H19NO8/c1-31-22(26)18-13-17(14-9-11-16(12-10-14)25(29)30)20(23(27)32-2)21(24(28)33-3)19(18)15-7-5-4-6-8-15/h4-13H,1-3H3 |
| InChIKey | TXJRETQSRZAWMY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|