C15H12N2O7 — CID 10882134
dimethyl 2-(4-nitrophenyl)-6-oxo-1H-pyridine-3,4-dicarboxylate (PubChem CID 10882134) has the molecular formula C15H12N2O7 and a molecular weight of 332.27 g/mol. Its IUPAC name is dimethyl 2-(4-nitrophenyl)-6-oxo-1H-pyridine-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(4-nitrophenyl)-6-oxo-1H-pyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10882134 |
| Molecular Formula | C15H12N2O7 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | dimethyl 2-(4-nitrophenyl)-6-oxo-1H-pyridine-3,4-dicarboxylate |
| SMILES | COC(=O)c1cc(=O)[nH]c(-c2ccc([N+](=O)[O-])cc2)c1C(=O)OC |
| InChI | InChI=1S/C15H12N2O7/c1-23-14(19)10-7-11(18)16-13(12(10)15(20)24-2)8-3-5-9(6-4-8)17(21)22/h3-7H,1-2H3,(H,16,18) |
| InChIKey | KASXWAXSVQNULY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|