C19H16N2O6 — CID 5329284
methyl 6,7-dimethoxy-2-(4-nitrophenyl)quinoline-3-carboxylate (PubChem CID 5329284) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is methyl 6,7-dimethoxy-2-(4-nitrophenyl)quinoline-3-carboxylate.
| Compound Name | methyl 6,7-dimethoxy-2-(4-nitrophenyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 5329284 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | methyl 6,7-dimethoxy-2-(4-nitrophenyl)quinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(OC)c(OC)cc2nc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N2O6/c1-25-16-9-12-8-14(19(22)27-3)18(20-15(12)10-17(16)26-2)11-4-6-13(7-5-11)21(23)24/h4-10H,1-3H3 |
| InChIKey | ZHROVCLRKOLMGN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|