methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate

C15H10N2O5 — CID 12000588

IUPACmethyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate
SMILESCOC(=O)c1cccc2nc(-c3ccc([N+](=O)[O-])cc3)oc12
InChIInChI=1S/C15H10N2O5/c1-21-15(18)11-3-2-4-12-13(11)22-14(16-12)9-5-7-10(8-6-9)17(19)20/h2-8H,1H3
InChIKeyORVCITQYMSWYFG-UHFFFAOYSA-N
MW298.25 g/mol
LogP3.19
Rot. Bonds3

About methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate

methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate (PubChem CID 12000588) has the molecular formula C15H10N2O5 and a molecular weight of 298.25 g/mol. Its IUPAC name is methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate.

Molecular Properties

Compound Namemethyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate
PubChem CID12000588
Molecular FormulaC15H10N2O5
Molecular Weight298.25 g/mol
Exact Mass298.06
IUPAC Namemethyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate
SMILESCOC(=O)c1cccc2nc(-c3ccc([N+](=O)[O-])cc3)oc12
InChIInChI=1S/C15H10N2O5/c1-21-15(18)11-3-2-4-12-13(11)22-14(16-12)9-5-7-10(8-6-9)17(19)20/h2-8H,1H3
InChIKeyORVCITQYMSWYFG-UHFFFAOYSA-N
XLogP3.19
TPSA95.47 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.25
LogP ≤ 53.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate?
The IUPAC name of methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate (CID 12000588) is methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate.
What is the SMILES notation for methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate?
The canonical SMILES for methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate is COC(=O)c1cccc2nc(-c3ccc([N+](=O)[O-])cc3)oc12.
What is the InChIKey of methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate?
The InChIKey is ORVCITQYMSWYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O5/c1-21-15(18)11-3-2-4-12-13(11)22-14(16-12)9-5-7-10(8-6-9)17(19)20/h2-8H,1H3.
What are the key properties of methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate?
methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate has a molecular weight of 298.25 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-nitrophenyl)-1,3-benzoxazole-7-carboxylate is sourced from PubChem (CID 12000588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).