C36H25NO4 — CID 135024818
methyl 3-nitro-5,6,7,8-tetraphenylnaphthalene-2-carboxylate (PubChem CID 135024818) has the molecular formula C36H25NO4 and a molecular weight of 535.60 g/mol. Its IUPAC name is methyl 3-nitro-5,6,7,8-tetraphenylnaphthalene-2-carboxylate.
| Compound Name | methyl 3-nitro-5,6,7,8-tetraphenylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 135024818 |
| Molecular Formula | C36H25NO4 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | methyl 3-nitro-5,6,7,8-tetraphenylnaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C36H25NO4/c1-41-36(38)30-22-28-29(23-31(30)37(39)40)33(25-16-8-3-9-17-25)35(27-20-12-5-13-21-27)34(26-18-10-4-11-19-26)32(28)24-14-6-2-7-15-24/h2-23H,1H3 |
| InChIKey | GTWOPBOWLUZQAU-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|