C48H31NO4 — CID 135025171
methyl 3-nitro-5,7,12,14-tetraphenylpentacene-2-carboxylate (PubChem CID 135025171) has the molecular formula C48H31NO4 and a molecular weight of 685.78 g/mol. Its IUPAC name is methyl 3-nitro-5,7,12,14-tetraphenylpentacene-2-carboxylate.
| Compound Name | methyl 3-nitro-5,7,12,14-tetraphenylpentacene-2-carboxylate |
|---|---|
| PubChem CID | 135025171 |
| Molecular Formula | C48H31NO4 |
| Molecular Weight | 685.78 g/mol |
| Exact Mass | 685.23 |
| IUPAC Name | methyl 3-nitro-5,7,12,14-tetraphenylpentacene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(-c3ccccc3)c3cc4c(-c5ccccc5)c5ccccc5c(-c5ccccc5)c4cc3c(-c3ccccc3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C48H31NO4/c1-53-48(50)42-28-40-41(29-43(42)49(51)52)47(33-22-12-5-13-23-33)39-27-37-36(26-38(39)46(40)32-20-10-4-11-21-32)44(30-16-6-2-7-17-30)34-24-14-15-25-35(34)45(37)31-18-8-3-9-19-31/h2-29H,1H3 |
| InChIKey | NPNYZVKJKJKSFZ-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.78 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|