About methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid
methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid (PubChem CID 160751815) has the molecular formula C23H16N2O8
and a molecular weight of 448.39 g/mol. Its IUPAC name is methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid.
Molecular Properties
| Compound Name | methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid |
| PubChem CID | 160751815 |
| Molecular Formula | C23H16N2O8 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc2ccccc12.O=C(O)c1cc([N+](=O)[O-])cc2ccccc12 |
| InChI | InChI=1S/C12H9NO4.C11H7NO4/c1-17-12(14)11-7-9(13(15)16)6-8-4-2-3-5-10(8)11;13-11(14)10-6-8(12(15)16)5-7-3-1-2-4-9(7)10/h2-7H,1H3;1-6H,(H,13,14) |
| InChIKey | RWXPWLSLHBDLPB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid?
The IUPAC name of methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid (CID 160751815) is methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid.
What is the SMILES notation for methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid?
The canonical SMILES for methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid is COC(=O)c1cc([N+](=O)[O-])cc2ccccc12.O=C(O)c1cc([N+](=O)[O-])cc2ccccc12.
What is the InChIKey of methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid?
The InChIKey is RWXPWLSLHBDLPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4.C11H7NO4/c1-17-12(14)11-7-9(13(15)16)6-8-4-2-3-5-10(8)11;13-11(14)10-6-8(12(15)16)5-7-3-1-2-4-9(7)10/h2-7H,1H3;1-6H,(H,13,14).
What are the key properties of methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid?
methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid has a molecular weight of 448.39 g/mol, XLogP of 4.98, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-nitronaphthalene-1-carboxylate;3-nitronaphthalene-1-carboxylic acid is sourced from PubChem (CID 160751815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).