C26H20O8 — CID 162019069
dimethyl naphthalene-1,4-dicarboxylate;naphthalene-1,4-dicarboxylic acid (PubChem CID 162019069) has the molecular formula C26H20O8 and a molecular weight of 460.44 g/mol. Its IUPAC name is dimethyl naphthalene-1,4-dicarboxylate;naphthalene-1,4-dicarboxylic acid.
| Compound Name | dimethyl naphthalene-1,4-dicarboxylate;naphthalene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 162019069 |
| Molecular Formula | C26H20O8 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | dimethyl naphthalene-1,4-dicarboxylate;naphthalene-1,4-dicarboxylic acid |
| SMILES | COC(=O)c1ccc(C(=O)OC)c2ccccc12.O=C(O)c1ccc(C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C14H12O4.C12H8O4/c1-17-13(15)11-7-8-12(14(16)18-2)10-6-4-3-5-9(10)11;13-11(14)9-5-6-10(12(15)16)8-4-2-1-3-7(8)9/h3-8H,1-2H3;1-6H,(H,13,14)(H,15,16) |
| InChIKey | YUMXJDSNIJUYLJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |